About 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine
4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (PubChem CID 167137622) has the molecular formula C12H17ClN4O
and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| PubChem CID | 167137622 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| SMILES | CN1CCC[C@@H](Nc2nnc(Cl)c3c2COC3)C1 |
| InChI | InChI=1S/C12H17ClN4O/c1-17-4-2-3-8(5-17)14-12-10-7-18-6-9(10)11(13)15-16-12/h8H,2-7H2,1H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | VMAZYCSGLATOKO-MRVPVSSYSA-N |
| XLogP | 1.67 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The IUPAC name of 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (CID 167137622) is 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
What is the SMILES notation for 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The canonical SMILES for 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is CN1CCC[C@@H](Nc2nnc(Cl)c3c2COC3)C1.
What is the InChIKey of 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The InChIKey is VMAZYCSGLATOKO-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H17ClN4O/c1-17-4-2-3-8(5-17)14-12-10-7-18-6-9(10)11(13)15-16-12/h8H,2-7H2,1H3,(H,14,16)/t8-/m1/s1.
What are the key properties of 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine has a molecular weight of 268.75 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R)-1-methylpiperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is sourced from PubChem (CID 167137622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).