About 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol
3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol (PubChem CID 167137807) has the molecular formula C12H16ClN3O2
and a molecular weight of 269.73 g/mol. Its IUPAC name is 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol |
| PubChem CID | 167137807 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol |
| SMILES | CC1(O)CC(Nc2nnc(Cl)c3c2COCC3)C1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-12(17)4-7(5-12)14-11-9-6-18-3-2-8(9)10(13)15-16-11/h7,17H,2-6H2,1H3,(H,14,16) |
| InChIKey | NAFPTLLLRPVBLI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol?
The IUPAC name of 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol (CID 167137807) is 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol.
What is the SMILES notation for 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol?
The canonical SMILES for 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol is CC1(O)CC(Nc2nnc(Cl)c3c2COCC3)C1.
What is the InChIKey of 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol?
The InChIKey is NAFPTLLLRPVBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3O2/c1-12(17)4-7(5-12)14-11-9-6-18-3-2-8(9)10(13)15-16-11/h7,17H,2-6H2,1H3,(H,14,16).
What are the key properties of 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol?
3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol has a molecular weight of 269.73 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-chloro-7,8-dihydro-5H-pyrano[3,4-d]pyridazin-4-yl)amino]-1-methylcyclobutan-1-ol is sourced from PubChem (CID 167137807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).