About N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine
N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine (PubChem CID 167138374) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine |
| PubChem CID | 167138374 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine |
| SMILES | C/C=C\C(=C\CCC)N(C)CN |
| InChI | InChI=1S/C10H20N2/c1-4-6-8-10(7-5-2)12(3)9-11/h5,7-8H,4,6,9,11H2,1-3H3/b7-5-,10-8- |
| InChIKey | JRGBALNZDILISZ-RRMOSLQNSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine?
The IUPAC name of N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine (CID 167138374) is N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine.
What is the SMILES notation for N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine?
The canonical SMILES for N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine is C/C=C\C(=C\CCC)N(C)CN.
What is the InChIKey of N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine?
The InChIKey is JRGBALNZDILISZ-RRMOSLQNSA-N. The full InChI is InChI=1S/C10H20N2/c1-4-6-8-10(7-5-2)12(3)9-11/h5,7-8H,4,6,9,11H2,1-3H3/b7-5-,10-8-.
What are the key properties of N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine?
N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine has a molecular weight of 168.28 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(2Z,4Z)-octa-2,4-dien-4-yl]methanediamine is sourced from PubChem (CID 167138374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).