C10H18FNO2S — CID 167138440
4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]sulfonylbutan-1-amine (PubChem CID 167138440) has the molecular formula C10H18FNO2S and a molecular weight of 235.32 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]sulfonylbutan-1-amine.
| Compound Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]sulfonylbutan-1-amine |
|---|---|
| PubChem CID | 167138440 |
| Molecular Formula | C10H18FNO2S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]sulfonylbutan-1-amine |
| SMILES | C/C=C(\C=C(/C)F)S(=O)(=O)CCCCN |
| InChI | InChI=1S/C10H18FNO2S/c1-3-10(8-9(2)11)15(13,14)7-5-4-6-12/h3,8H,4-7,12H2,1-2H3/b9-8+,10-3+ |
| InChIKey | PARWVUPFDHUOAP-UTDLVPNFSA-N |
| XLogP | 1.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|