C10H16FIN2O2S — CID 167138483
(2E,4Z)-2-fluoro-N-[2-(iodoamino)ethyl]octa-2,4,7-triene-1-sulfonamide (PubChem CID 167138483) has the molecular formula C10H16FIN2O2S and a molecular weight of 374.22 g/mol. Its IUPAC name is (2E,4Z)-2-fluoro-N-[2-(iodoamino)ethyl]octa-2,4,7-triene-1-sulfonamide.
| Compound Name | (2E,4Z)-2-fluoro-N-[2-(iodoamino)ethyl]octa-2,4,7-triene-1-sulfonamide |
|---|---|
| PubChem CID | 167138483 |
| Molecular Formula | C10H16FIN2O2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | (2E,4Z)-2-fluoro-N-[2-(iodoamino)ethyl]octa-2,4,7-triene-1-sulfonamide |
| SMILES | C=CC/C=C\C=C(\F)CS(=O)(=O)NCCNI |
| InChI | InChI=1S/C10H16FIN2O2S/c1-2-3-4-5-6-10(11)9-17(15,16)14-8-7-13-12/h2,4-6,13-14H,1,3,7-9H2/b5-4-,10-6+ |
| InChIKey | BMCFPPCCZJKUOO-VWJYOPCBSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|