About 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine
2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine (PubChem CID 167138528) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine |
| PubChem CID | 167138528 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine |
| SMILES | C/C=C\C=c1\[nH]cc(CCN(C)C)\c1=C\C |
| InChI | InChI=1S/C14H22N2/c1-5-7-8-14-13(6-2)12(11-15-14)9-10-16(3)4/h5-8,11,15H,9-10H2,1-4H3/b7-5-,13-6-,14-8+ |
| InChIKey | HMLVNEXCESADMH-DXCNYTGTSA-N |
| XLogP | 1.28 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine (CID 167138528) is 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine is C/C=C\C=c1\[nH]cc(CCN(C)C)\c1=C\C.
What is the InChIKey of 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine?
The InChIKey is HMLVNEXCESADMH-DXCNYTGTSA-N. The full InChI is InChI=1S/C14H22N2/c1-5-7-8-14-13(6-2)12(11-15-14)9-10-16(3)4/h5-8,11,15H,9-10H2,1-4H3/b7-5-,13-6-,14-8+.
What are the key properties of 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine?
2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine has a molecular weight of 218.34 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1H-pyrrol-3-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 167138528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).