C14H19NS — CID 167138529
N-[(1Z)-3-[(3Z,5Z)-octa-1,3,5-trien-2-yl]sulfanylbuta-1,3-dienyl]ethanimine (PubChem CID 167138529) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is N-[(1Z)-3-[(3Z,5Z)-octa-1,3,5-trien-2-yl]sulfanylbuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1Z)-3-[(3Z,5Z)-octa-1,3,5-trien-2-yl]sulfanylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 167138529 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[(1Z)-3-[(3Z,5Z)-octa-1,3,5-trien-2-yl]sulfanylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(/C=C\C=C/CC)SC(=C)/C=C\N=C\C |
| InChI | InChI=1S/C14H19NS/c1-5-7-8-9-10-13(3)16-14(4)11-12-15-6-2/h6-12H,3-5H2,1-2H3/b8-7-,10-9-,12-11-,15-6+ |
| InChIKey | FLUVPKBOMVQJQP-XUITVBTLSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|