About N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide
N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide (PubChem CID 167138828) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide |
| PubChem CID | 167138828 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ncc(C(=O)NCCN2CC(C)(C)C2)cc1NC=O |
| InChI | InChI=1S/C15H22N4O2/c1-11-13(18-10-20)6-12(7-17-11)14(21)16-4-5-19-8-15(2,3)9-19/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,21)(H,18,20) |
| InChIKey | ZGESYEUHLXQZFD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide?
The IUPAC name of N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide (CID 167138828) is N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide.
What is the SMILES notation for N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide?
The canonical SMILES for N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide is Cc1ncc(C(=O)NCCN2CC(C)(C)C2)cc1NC=O.
What is the InChIKey of N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide?
The InChIKey is ZGESYEUHLXQZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-11-13(18-10-20)6-12(7-17-11)14(21)16-4-5-19-8-15(2,3)9-19/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,21)(H,18,20).
What are the key properties of N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide?
N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide has a molecular weight of 290.37 g/mol, XLogP of 1.03, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-dimethylazetidin-1-yl)ethyl]-5-formamido-6-methylpyridine-3-carboxamide is sourced from PubChem (CID 167138828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).