About ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate
ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate (PubChem CID 167138943) has the molecular formula C22H42O5
and a molecular weight of 386.57 g/mol. Its IUPAC name is ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate.
Molecular Properties
| Compound Name | ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate |
| PubChem CID | 167138943 |
| Molecular Formula | C22H42O5 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate |
| SMILES | CCCC(C)(C(=O)OC(C)(C)C(C)(C)CCCCC(=O)OCC)C(C)(C)O |
| InChI | InChI=1S/C22H42O5/c1-10-15-22(9,20(5,6)25)18(24)27-21(7,8)19(3,4)16-13-12-14-17(23)26-11-2/h25H,10-16H2,1-9H3 |
| InChIKey | GJZKWHDWZQNLEE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate?
The IUPAC name of ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate (CID 167138943) is ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate.
What is the SMILES notation for ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate?
The canonical SMILES for ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate is CCCC(C)(C(=O)OC(C)(C)C(C)(C)CCCCC(=O)OCC)C(C)(C)O.
What is the InChIKey of ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate?
The InChIKey is GJZKWHDWZQNLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O5/c1-10-15-22(9,20(5,6)25)18(24)27-21(7,8)19(3,4)16-13-12-14-17(23)26-11-2/h25H,10-16H2,1-9H3.
What are the key properties of ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate?
ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate has a molecular weight of 386.57 g/mol, XLogP of 5.04, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[2-(2-hydroxypropan-2-yl)-2-methylpentanoyl]oxy-6,6,7-trimethyloctanoate is sourced from PubChem (CID 167138943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).