C22H19F2N7O2S — CID 167139019
5-[[2-(3,3-difluoroazetidin-1-yl)ethylamino]-hydroxymethyl]-13-pyridin-4-yl-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one (PubChem CID 167139019) has the molecular formula C22H19F2N7O2S and a molecular weight of 483.50 g/mol. Its IUPAC name is 5-[[2-(3,3-difluoroazetidin-1-yl)ethylamino]-hydroxymethyl]-13-pyridin-4-yl-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one.
| Compound Name | 5-[[2-(3,3-difluoroazetidin-1-yl)ethylamino]-hydroxymethyl]-13-pyridin-4-yl-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one |
|---|---|
| PubChem CID | 167139019 |
| Molecular Formula | C22H19F2N7O2S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 5-[[2-(3,3-difluoroazetidin-1-yl)ethylamino]-hydroxymethyl]-13-pyridin-4-yl-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one |
| SMILES | O=c1[nH]c2cc(C(O)NCCN3CC(F)(F)C3)cnc2c2nn3cc(-c4ccncc4)sc3c12 |
| InChI | InChI=1S/C22H19F2N7O2S/c23-22(24)10-30(11-22)6-5-26-19(32)13-7-14-17(27-8-13)18-16(20(33)28-14)21-31(29-18)9-15(34-21)12-1-3-25-4-2-12/h1-4,7-9,19,26,32H,5-6,10-11H2,(H,28,33) |
| InChIKey | FDXFNFXGUJPHTR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|