About 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol
1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol (PubChem CID 167139069) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol |
| PubChem CID | 167139069 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol |
| SMILES | CC1(C)CN(CC(N)O)C1 |
| InChI | InChI=1S/C7H16N2O/c1-7(2)4-9(5-7)3-6(8)10/h6,10H,3-5,8H2,1-2H3 |
| InChIKey | FRVOXRXIMACNSE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol?
The IUPAC name of 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol (CID 167139069) is 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol.
What is the SMILES notation for 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol?
The canonical SMILES for 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol is CC1(C)CN(CC(N)O)C1.
What is the InChIKey of 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol?
The InChIKey is FRVOXRXIMACNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-7(2)4-9(5-7)3-6(8)10/h6,10H,3-5,8H2,1-2H3.
What are the key properties of 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol?
1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol has a molecular weight of 144.22 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(3,3-dimethylazetidin-1-yl)ethanol is sourced from PubChem (CID 167139069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).