C24H26F2N8O3S — CID 167139648
5-[[2-(3,3-difluoropyrrolidin-1-yl)ethylamino]-hydroxymethyl]-13-[1-(2-methoxyethyl)pyrazol-4-yl]-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one (PubChem CID 167139648) has the molecular formula C24H26F2N8O3S and a molecular weight of 544.59 g/mol. Its IUPAC name is 5-[[2-(3,3-difluoropyrrolidin-1-yl)ethylamino]-hydroxymethyl]-13-[1-(2-methoxyethyl)pyrazol-4-yl]-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one.
| Compound Name | 5-[[2-(3,3-difluoropyrrolidin-1-yl)ethylamino]-hydroxymethyl]-13-[1-(2-methoxyethyl)pyrazol-4-yl]-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one |
|---|---|
| PubChem CID | 167139648 |
| Molecular Formula | C24H26F2N8O3S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 5-[[2-(3,3-difluoropyrrolidin-1-yl)ethylamino]-hydroxymethyl]-13-[1-(2-methoxyethyl)pyrazol-4-yl]-12-thia-3,8,15,16-tetrazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2(7),3,5,10,13-hexaen-9-one |
| SMILES | COCCn1cc(-c2cn3nc4c5ncc(C(O)NCCN6CCC(F)(F)C6)cc5[nH]c(=O)c4c3s2)cn1 |
| InChI | InChI=1S/C24H26F2N8O3S/c1-37-7-6-33-11-15(10-29-33)17-12-34-23(38-17)18-20(31-34)19-16(30-22(18)36)8-14(9-28-19)21(35)27-3-5-32-4-2-24(25,26)13-32/h8-12,21,27,35H,2-7,13H2,1H3,(H,30,36) |
| InChIKey | ISRDEQNAETYFIM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 125.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|