C13H20FN — CID 167141132
(2R)-1-ethyl-2-[(3Z,5E)-6-fluorohepta-1,3,5-trien-2-yl]pyrrolidine (PubChem CID 167141132) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (2R)-1-ethyl-2-[(3Z,5E)-6-fluorohepta-1,3,5-trien-2-yl]pyrrolidine.
| Compound Name | (2R)-1-ethyl-2-[(3Z,5E)-6-fluorohepta-1,3,5-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 167141132 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (2R)-1-ethyl-2-[(3Z,5E)-6-fluorohepta-1,3,5-trien-2-yl]pyrrolidine |
| SMILES | C=C(/C=C\C=C(/C)F)[C@H]1CCCN1CC |
| InChI | InChI=1S/C13H20FN/c1-4-15-10-6-9-13(15)11(2)7-5-8-12(3)14/h5,7-8,13H,2,4,6,9-10H2,1,3H3/b7-5-,12-8+/t13-/m1/s1 |
| InChIKey | YKVKRDKNTCDSAJ-QSPZINCISA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|