C10H19N — CID 167142264
(1R,2S,3S,4S)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine (PubChem CID 167142264) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2S,3S,4S)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 167142264 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (1R,2S,3S,4S)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC(C)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1N |
| InChI | InChI=1S/C10H19N/c1-6(2)9-7-3-4-8(5-7)10(9)11/h6-10H,3-5,11H2,1-2H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | SHXVJSFOJHMEEQ-JXUBOQSCSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |