C23H14F3N5O3 — CID 167142286
2,3-dioxo-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]phenyl]-1H-indole-7-carboxamide (PubChem CID 167142286) has the molecular formula C23H14F3N5O3 and a molecular weight of 465.39 g/mol. Its IUPAC name is 2,3-dioxo-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]phenyl]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dioxo-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 167142286 |
| Molecular Formula | C23H14F3N5O3 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2,3-dioxo-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]phenyl]-1H-indole-7-carboxamide |
| SMILES | O=C1Nc2c(C(=O)Nc3ccc(Nc4cccc5nc(C(F)(F)F)cn45)cc3)cccc2C1=O |
| InChI | InChI=1S/C23H14F3N5O3/c24-23(25,26)16-11-31-17(5-2-6-18(31)29-16)27-12-7-9-13(10-8-12)28-21(33)15-4-1-3-14-19(15)30-22(34)20(14)32/h1-11,27H,(H,28,33)(H,30,32,34) |
| InChIKey | GKXPFEPCEQBRKQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|