C27H25FN6O3S — CID 167142462
N-[(4aS)-3-(5-fluoropyrimidin-2-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-2-(1,5-dimethyl-3-thiophen-2-ylpyrrol-2-yl)-2-oxoacetamide (PubChem CID 167142462) has the molecular formula C27H25FN6O3S and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[(4aS)-3-(5-fluoropyrimidin-2-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-2-(1,5-dimethyl-3-thiophen-2-ylpyrrol-2-yl)-2-oxoacetamide.
| Compound Name | N-[(4aS)-3-(5-fluoropyrimidin-2-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-2-(1,5-dimethyl-3-thiophen-2-ylpyrrol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 167142462 |
| Molecular Formula | C27H25FN6O3S |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | N-[(4aS)-3-(5-fluoropyrimidin-2-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-2-(1,5-dimethyl-3-thiophen-2-ylpyrrol-2-yl)-2-oxoacetamide |
| SMILES | Cc1cc(-c2cccs2)c(C(=O)C(=O)Nc2ccc3c(c2)OC[C@@H]2CN(c4ncc(F)cn4)CCN32)n1C |
| InChI | InChI=1S/C27H25FN6O3S/c1-16-10-20(23-4-3-9-38-23)24(32(16)2)25(35)26(36)31-18-5-6-21-22(11-18)37-15-19-14-33(7-8-34(19)21)27-29-12-17(28)13-30-27/h3-6,9-13,19H,7-8,14-15H2,1-2H3,(H,31,36)/t19-/m0/s1 |
| InChIKey | GTDZJTWWTABVMJ-IBGZPJMESA-N |
| XLogP | 3.90 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|