C19H15F2IN6O4S — CID 167142740
2-[3-[2-(difluoromethoxy)-5-iodosulfanylphenyl]-4-[[hydroxy(pyrazolo[1,5-a]pyrimidin-3-yl)methyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 167142740) has the molecular formula C19H15F2IN6O4S and a molecular weight of 588.33 g/mol. Its IUPAC name is 2-[3-[2-(difluoromethoxy)-5-iodosulfanylphenyl]-4-[[hydroxy(pyrazolo[1,5-a]pyrimidin-3-yl)methyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-(difluoromethoxy)-5-iodosulfanylphenyl]-4-[[hydroxy(pyrazolo[1,5-a]pyrimidin-3-yl)methyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 167142740 |
| Molecular Formula | C19H15F2IN6O4S |
| Molecular Weight | 588.33 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | 2-[3-[2-(difluoromethoxy)-5-iodosulfanylphenyl]-4-[[hydroxy(pyrazolo[1,5-a]pyrimidin-3-yl)methyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(O)c2cnn3cccnc23)c(-c2cc(SI)ccc2OC(F)F)n1 |
| InChI | InChI=1S/C19H15F2IN6O4S/c20-19(21)32-14-3-2-10(33-22)6-11(14)16-13(8-27(26-16)9-15(29)30)25-18(31)12-7-24-28-5-1-4-23-17(12)28/h1-8,18-19,25,31H,9H2,(H,29,30) |
| InChIKey | FDEIYMKMZSMWEH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|