C29H33FN2O2 — CID 167145598
(E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-8-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)oct-1-en-3-ol (PubChem CID 167145598) has the molecular formula C29H33FN2O2 and a molecular weight of 460.59 g/mol. Its IUPAC name is (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-8-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)oct-1-en-3-ol.
| Compound Name | (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-8-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)oct-1-en-3-ol |
|---|---|
| PubChem CID | 167145598 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-8-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)oct-1-en-3-ol |
| SMILES | O[C@@H](/C=C/c1ccc(OCc2ccccc2)c(F)c1)CCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C29H33FN2O2/c30-27-20-22(14-18-28(27)34-21-23-8-3-1-4-9-23)13-17-26(33)12-6-2-5-11-25-16-15-24-10-7-19-31-29(24)32-25/h1,3-4,8-9,13-18,20,26,33H,2,5-7,10-12,19,21H2,(H,31,32)/b17-13+/t26-/m1/s1 |
| InChIKey | WOOJAICIJBPEDR-HHTJIARGSA-N |
| XLogP | 6.34 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|