C22H27NO22S3 — CID 167146505
4,5-dihydroxy-3-[5-hydroxy-3-(sulfoamino)-4-sulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid (PubChem CID 167146505) has the molecular formula C22H27NO22S3 and a molecular weight of 753.64 g/mol. Its IUPAC name is 4,5-dihydroxy-3-[5-hydroxy-3-(sulfoamino)-4-sulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid.
| Compound Name | 4,5-dihydroxy-3-[5-hydroxy-3-(sulfoamino)-4-sulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 167146505 |
| Molecular Formula | C22H27NO22S3 |
| Molecular Weight | 753.64 g/mol |
| Exact Mass | 753.02 |
| IUPAC Name | 4,5-dihydroxy-3-[5-hydroxy-3-(sulfoamino)-4-sulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
| SMILES | Cc1cc(=O)oc2cc(OC3OC(C(=O)O)C(OC4OC(COS(=O)(=O)O)C(O)C(OS(=O)(=O)O)C4NS(=O)(=O)O)C(O)C3O)ccc12 |
| InChI | InChI=1S/C22H27NO22S3/c1-7-4-12(24)41-10-5-8(2-3-9(7)10)40-22-16(27)15(26)18(19(44-22)20(28)29)43-21-13(23-46(30,31)32)17(45-48(36,37)38)14(25)11(42-21)6-39-47(33,34)35/h2-5,11,13-19,21-23,25-27H,6H2,1H3,(H,28,29)(H,30,31,32)(H,33,34,35)(H,36,37,38) |
| InChIKey | QUEZNVRVWBPUNV-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 358.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.64 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|