About 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole
3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole (PubChem CID 167147131) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole |
| PubChem CID | 167147131 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole |
| SMILES | C/C=C\c1[nH]c2c(c1C)CCC=C2 |
| InChI | InChI=1S/C12H15N/c1-3-6-11-9(2)10-7-4-5-8-12(10)13-11/h3,5-6,8,13H,4,7H2,1-2H3/b6-3- |
| InChIKey | GDJMBQQWGKOEMM-UTCJRWHESA-N |
| XLogP | 3.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole?
The IUPAC name of 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole (CID 167147131) is 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole.
What is the SMILES notation for 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole?
The canonical SMILES for 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole is C/C=C\c1[nH]c2c(c1C)CCC=C2.
What is the InChIKey of 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole?
The InChIKey is GDJMBQQWGKOEMM-UTCJRWHESA-N. The full InChI is InChI=1S/C12H15N/c1-3-6-11-9(2)10-7-4-5-8-12(10)13-11/h3,5-6,8,13H,4,7H2,1-2H3/b6-3-.
What are the key properties of 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole?
3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole has a molecular weight of 173.26 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(Z)-prop-1-enyl]-4,5-dihydro-1H-indole is sourced from PubChem (CID 167147131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).