C18H27NO2 — CID 167147409
methyl (1S,2R)-7-amino-1-methyl-1-pentyl-3,4-dihydro-2H-naphthalene-2-carboxylate (PubChem CID 167147409) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is methyl (1S,2R)-7-amino-1-methyl-1-pentyl-3,4-dihydro-2H-naphthalene-2-carboxylate.
| Compound Name | methyl (1S,2R)-7-amino-1-methyl-1-pentyl-3,4-dihydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 167147409 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | methyl (1S,2R)-7-amino-1-methyl-1-pentyl-3,4-dihydro-2H-naphthalene-2-carboxylate |
| SMILES | CCCCC[C@]1(C)c2cc(N)ccc2CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H27NO2/c1-4-5-6-11-18(2)15(17(20)21-3)10-8-13-7-9-14(19)12-16(13)18/h7,9,12,15H,4-6,8,10-11,19H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | NSBYNLQWWNDFFO-YJBOKZPZSA-N |
| XLogP | 3.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|