C16H28F2O2 — CID 167147533
(4R)-4-[(2S,3S,5S)-5-fluoro-3-(fluoromethyl)-2,6-dimethylhept-6-enyl]-2-propyl-1,3-dioxolane (PubChem CID 167147533) has the molecular formula C16H28F2O2 and a molecular weight of 290.39 g/mol. Its IUPAC name is (4R)-4-[(2S,3S,5S)-5-fluoro-3-(fluoromethyl)-2,6-dimethylhept-6-enyl]-2-propyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(2S,3S,5S)-5-fluoro-3-(fluoromethyl)-2,6-dimethylhept-6-enyl]-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 167147533 |
| Molecular Formula | C16H28F2O2 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (4R)-4-[(2S,3S,5S)-5-fluoro-3-(fluoromethyl)-2,6-dimethylhept-6-enyl]-2-propyl-1,3-dioxolane |
| SMILES | C=C(C)[C@@H](F)C[C@H](CF)[C@@H](C)C[C@@H]1COC(CCC)O1 |
| InChI | InChI=1S/C16H28F2O2/c1-5-6-16-19-10-14(20-16)7-12(4)13(9-17)8-15(18)11(2)3/h12-16H,2,5-10H2,1,3-4H3/t12-,13+,14+,15-,16?/m0/s1 |
| InChIKey | WJZAKYYBQOIRPV-JSKHOMAGSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|