About N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine
N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine (PubChem CID 167148048) has the molecular formula C14H22FN
and a molecular weight of 223.33 g/mol. Its IUPAC name is N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 167148048 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine |
| SMILES | C=CNC1=C(C(C)C)CC(F)C=C1C(C)C |
| InChI | InChI=1S/C14H22FN/c1-6-16-14-12(9(2)3)7-11(15)8-13(14)10(4)5/h6-7,9-11,16H,1,8H2,2-5H3 |
| InChIKey | YFELNYWAOYNMTP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine (CID 167148048) is N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine is C=CNC1=C(C(C)C)CC(F)C=C1C(C)C.
What is the InChIKey of N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The InChIKey is YFELNYWAOYNMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FN/c1-6-16-14-12(9(2)3)7-11(15)8-13(14)10(4)5/h6-7,9-11,16H,1,8H2,2-5H3.
What are the key properties of N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine has a molecular weight of 223.33 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4-fluoro-2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 167148048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).