C21H22N4O3 — CID 167148403
5-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 167148403) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | 5-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 167148403 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 5-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)N/C(N)=C/C=C\N)cc2c1OCC2c1ccccc1 |
| InChI | InChI=1S/C21H22N4O3/c1-24-21(27)16-11-14(20(26)25-18(23)8-5-9-22)10-15-17(12-28-19(15)16)13-6-3-2-4-7-13/h2-11,17H,12,22-23H2,1H3,(H,24,27)(H,25,26)/b9-5-,18-8+ |
| InChIKey | IOKVVVGHDAXNSG-MZHOJPJSSA-N |
| XLogP | 1.57 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|