C27H36N4OS — CID 167148469
N-[4-[(dimethylamino)methyl]phenyl]sulfanyl-2-[4-(1-methylpyrazol-4-yl)-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 167148469) has the molecular formula C27H36N4OS and a molecular weight of 464.68 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]phenyl]sulfanyl-2-[4-(1-methylpyrazol-4-yl)-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | N-[4-[(dimethylamino)methyl]phenyl]sulfanyl-2-[4-(1-methylpyrazol-4-yl)-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 167148469 |
| Molecular Formula | C27H36N4OS |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]phenyl]sulfanyl-2-[4-(1-methylpyrazol-4-yl)-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cc(-c2cnn(C)c2)cc(C(C)C)c1CC(=O)NSc1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C27H36N4OS/c1-18(2)24-12-21(22-15-28-31(7)17-22)13-25(19(3)4)26(24)14-27(32)29-33-23-10-8-20(9-11-23)16-30(5)6/h8-13,15,17-19H,14,16H2,1-7H3,(H,29,32) |
| InChIKey | NYKKVKHJXCDWQQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|