C16H24F2N2 — CID 167148982
4,4-difluoro-N'-methyl-N-[(5-methylcyclohexa-2,4-dien-1-yl)methyl]cyclohexane-1-carboximidamide (PubChem CID 167148982) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4,4-difluoro-N'-methyl-N-[(5-methylcyclohexa-2,4-dien-1-yl)methyl]cyclohexane-1-carboximidamide.
| Compound Name | 4,4-difluoro-N'-methyl-N-[(5-methylcyclohexa-2,4-dien-1-yl)methyl]cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 167148982 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4,4-difluoro-N'-methyl-N-[(5-methylcyclohexa-2,4-dien-1-yl)methyl]cyclohexane-1-carboximidamide |
| SMILES | C/N=C(\NCC1C=CC=C(C)C1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H24F2N2/c1-12-4-3-5-13(10-12)11-20-15(19-2)14-6-8-16(17,18)9-7-14/h3-5,13-14H,6-11H2,1-2H3,(H,19,20) |
| InChIKey | MYJKJWXDFMAMCH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|