C16H28F2N2 — CID 167149025
4,4-difluoro-N'-methyl-N-[(Z)-5-methylhept-3-enyl]cyclohexane-1-carboximidamide (PubChem CID 167149025) has the molecular formula C16H28F2N2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 4,4-difluoro-N'-methyl-N-[(Z)-5-methylhept-3-enyl]cyclohexane-1-carboximidamide.
| Compound Name | 4,4-difluoro-N'-methyl-N-[(Z)-5-methylhept-3-enyl]cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 167149025 |
| Molecular Formula | C16H28F2N2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 4,4-difluoro-N'-methyl-N-[(Z)-5-methylhept-3-enyl]cyclohexane-1-carboximidamide |
| SMILES | CCC(C)/C=C\CCN/C(=N\C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H28F2N2/c1-4-13(2)7-5-6-12-20-15(19-3)14-8-10-16(17,18)11-9-14/h5,7,13-14H,4,6,8-12H2,1-3H3,(H,19,20)/b7-5- |
| InChIKey | UHQSKQMTGCSSEQ-ALCCZGGFSA-N |
| XLogP | 4.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|