About 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium
1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium (PubChem CID 167149050) has the molecular formula C13H22NO+
and a molecular weight of 208.32 g/mol. Its IUPAC name is 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium.
Molecular Properties
| Compound Name | 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium |
| PubChem CID | 167149050 |
| Molecular Formula | C13H22NO+ |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium |
| SMILES | Cc1ccc(CC(C)C(C)(C)C)c[n+]1O |
| InChI | InChI=1S/C13H22NO/c1-10(13(3,4)5)8-12-7-6-11(2)14(15)9-12/h6-7,9-10,15H,8H2,1-5H3/q+1 |
| InChIKey | UHHVRBFFSXAFBX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium?
The IUPAC name of 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium (CID 167149050) is 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium.
What is the SMILES notation for 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium?
The canonical SMILES for 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium is Cc1ccc(CC(C)C(C)(C)C)c[n+]1O.
What is the InChIKey of 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium?
The InChIKey is UHHVRBFFSXAFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22NO/c1-10(13(3,4)5)8-12-7-6-11(2)14(15)9-12/h6-7,9-10,15H,8H2,1-5H3/q+1.
What are the key properties of 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium?
1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium has a molecular weight of 208.32 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-methyl-5-(2,3,3-trimethylbutyl)pyridin-1-ium is sourced from PubChem (CID 167149050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).