C21H34F5N3 — CID 167149099
N-ethyl-3,3-difluoro-N'-[(Z)-5-propan-2-yl-9-(2,2,2-trifluoroethylimino)non-3-enyl]cyclobutane-1-carboximidamide (PubChem CID 167149099) has the molecular formula C21H34F5N3 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-ethyl-3,3-difluoro-N'-[(Z)-5-propan-2-yl-9-(2,2,2-trifluoroethylimino)non-3-enyl]cyclobutane-1-carboximidamide.
| Compound Name | N-ethyl-3,3-difluoro-N'-[(Z)-5-propan-2-yl-9-(2,2,2-trifluoroethylimino)non-3-enyl]cyclobutane-1-carboximidamide |
|---|---|
| PubChem CID | 167149099 |
| Molecular Formula | C21H34F5N3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | N-ethyl-3,3-difluoro-N'-[(Z)-5-propan-2-yl-9-(2,2,2-trifluoroethylimino)non-3-enyl]cyclobutane-1-carboximidamide |
| SMILES | CCN/C(=N\CC/C=C\C(CCC/C=N/CC(F)(F)F)C(C)C)C1CC(F)(F)C1 |
| InChI | InChI=1S/C21H34F5N3/c1-4-28-19(18-13-20(22,23)14-18)29-12-8-6-10-17(16(2)3)9-5-7-11-27-15-21(24,25)26/h6,10-11,16-18H,4-5,7-9,12-15H2,1-3H3,(H,28,29)/b10-6-,27-11+ |
| InChIKey | NKEICLIHNOORSG-ZGHXZBDWSA-N |
| XLogP | 6.06 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|