C17H24F2N2 — CID 167149117
4,4-difluoro-N'-methyl-N-[1-(4-methylcyclohexa-2,4-dien-1-yl)ethenyl]cyclohexane-1-carboximidamide (PubChem CID 167149117) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4,4-difluoro-N'-methyl-N-[1-(4-methylcyclohexa-2,4-dien-1-yl)ethenyl]cyclohexane-1-carboximidamide.
| Compound Name | 4,4-difluoro-N'-methyl-N-[1-(4-methylcyclohexa-2,4-dien-1-yl)ethenyl]cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 167149117 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4,4-difluoro-N'-methyl-N-[1-(4-methylcyclohexa-2,4-dien-1-yl)ethenyl]cyclohexane-1-carboximidamide |
| SMILES | C=C(N/C(=N\C)C1CCC(F)(F)CC1)C1C=CC(C)=CC1 |
| InChI | InChI=1S/C17H24F2N2/c1-12-4-6-14(7-5-12)13(2)21-16(20-3)15-8-10-17(18,19)11-9-15/h4-6,14-15H,2,7-11H2,1,3H3,(H,20,21) |
| InChIKey | OMUOIZPSOKERDC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|