C20H24F5N3 — CID 167149151
N-[(5Z,7E)-7-[2-(3,3-difluorocyclobutyl)-1H-imidazol-5-yl]deca-5,7,9-trienyl]-3,3,3-trifluoropropan-1-imine (PubChem CID 167149151) has the molecular formula C20H24F5N3 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[(5Z,7E)-7-[2-(3,3-difluorocyclobutyl)-1H-imidazol-5-yl]deca-5,7,9-trienyl]-3,3,3-trifluoropropan-1-imine.
| Compound Name | N-[(5Z,7E)-7-[2-(3,3-difluorocyclobutyl)-1H-imidazol-5-yl]deca-5,7,9-trienyl]-3,3,3-trifluoropropan-1-imine |
|---|---|
| PubChem CID | 167149151 |
| Molecular Formula | C20H24F5N3 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(5Z,7E)-7-[2-(3,3-difluorocyclobutyl)-1H-imidazol-5-yl]deca-5,7,9-trienyl]-3,3,3-trifluoropropan-1-imine |
| SMILES | C=C/C=C(\C=C/CCCC/N=C/CC(F)(F)F)c1cnc(C2CC(F)(F)C2)[nH]1 |
| InChI | InChI=1S/C20H24F5N3/c1-2-7-15(8-5-3-4-6-10-26-11-9-20(23,24)25)17-14-27-18(28-17)16-12-19(21,22)13-16/h2,5,7-8,11,14,16H,1,3-4,6,9-10,12-13H2,(H,27,28)/b8-5-,15-7+,26-11+ |
| InChIKey | OPISCWGOXNXRGJ-GMSBMUHUSA-N |
| XLogP | 6.24 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|