C11H18N2 — CID 167149758
1-(4-methyl-3-prop-2-enyl-1,2,3,6-tetrahydropyridin-6-yl)ethenamine (PubChem CID 167149758) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(4-methyl-3-prop-2-enyl-1,2,3,6-tetrahydropyridin-6-yl)ethenamine.
| Compound Name | 1-(4-methyl-3-prop-2-enyl-1,2,3,6-tetrahydropyridin-6-yl)ethenamine |
|---|---|
| PubChem CID | 167149758 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(4-methyl-3-prop-2-enyl-1,2,3,6-tetrahydropyridin-6-yl)ethenamine |
| SMILES | C=CCC1CNC(C(=C)N)C=C1C |
| InChI | InChI=1S/C11H18N2/c1-4-5-10-7-13-11(9(3)12)6-8(10)2/h4,6,10-11,13H,1,3,5,7,12H2,2H3 |
| InChIKey | IVVXOHWIPRLXKC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|