C12H13F2NO — CID 167149888
6-[(1E,3Z)-1,2-difluorohexa-1,3,5-trienyl]-5-methyl-3,4-dihydro-1H-pyridin-2-one (PubChem CID 167149888) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 6-[(1E,3Z)-1,2-difluorohexa-1,3,5-trienyl]-5-methyl-3,4-dihydro-1H-pyridin-2-one.
| Compound Name | 6-[(1E,3Z)-1,2-difluorohexa-1,3,5-trienyl]-5-methyl-3,4-dihydro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 167149888 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 6-[(1E,3Z)-1,2-difluorohexa-1,3,5-trienyl]-5-methyl-3,4-dihydro-1H-pyridin-2-one |
| SMILES | C=C/C=C\C(F)=C(/F)C1=C(C)CCC(=O)N1 |
| InChI | InChI=1S/C12H13F2NO/c1-3-4-5-9(13)11(14)12-8(2)6-7-10(16)15-12/h3-5H,1,6-7H2,2H3,(H,15,16)/b5-4-,11-9+ |
| InChIKey | KXHKOBBNYLCONJ-JHGYFVHDSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|