C13H18N2O3S — CID 167150606
(4R)-2-[(E)-but-2-enyl]-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepine 1,1-dioxide (PubChem CID 167150606) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is (4R)-2-[(E)-but-2-enyl]-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepine 1,1-dioxide.
| Compound Name | (4R)-2-[(E)-but-2-enyl]-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 167150606 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (4R)-2-[(E)-but-2-enyl]-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepine 1,1-dioxide |
| SMILES | C/C=C/CN1C[C@@H](CC)Oc2ccncc2S1(=O)=O |
| InChI | InChI=1S/C13H18N2O3S/c1-3-5-8-15-10-11(4-2)18-12-6-7-14-9-13(12)19(15,16)17/h3,5-7,9,11H,4,8,10H2,1-2H3/b5-3+/t11-/m1/s1 |
| InChIKey | ATIBPPUAZSNVEN-JOAKQRRISA-N |
| XLogP | 1.82 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|