C47H58O7 — CID 167151290
[4-[4-acetyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl]oxycarbonyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl] acetate (PubChem CID 167151290) has the molecular formula C47H58O7 and a molecular weight of 734.97 g/mol. Its IUPAC name is [4-[4-acetyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl]oxycarbonyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl] acetate.
| Compound Name | [4-[4-acetyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl]oxycarbonyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 167151290 |
| Molecular Formula | C47H58O7 |
| Molecular Weight | 734.97 g/mol |
| Exact Mass | 734.42 |
| IUPAC Name | [4-[4-acetyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl]oxycarbonyloxy-2-methyl-3-[(E)-2,5,6-trimethylhept-4-en-2-yl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C(C)(C)C/C=C(\C)C(C)C)c(OC(=O)Oc2c(C)c(C(C)(C)C/C=C(\C)C(C)C)c(OC(C)=O)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C47H58O7/c1-27(2)29(5)23-25-46(11,12)39-32(8)42(36-20-16-17-21-37(36)43(39)52-34(10)49)53-45(50)54-44-38-22-18-15-19-35(38)41(51-33(9)48)31(7)40(44)47(13,14)26-24-30(6)28(3)4/h15-24,27-28H,25-26H2,1-14H3/b29-23+,30-24+ |
| InChIKey | BGLISJYJUMDONV-HCTXVGCHSA-N |
| XLogP | 12.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.97 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|