C23H23ClN2O3S — CID 167151971
2-(7a-formyl-3-oxo-1,3a,4,5,6,7-hexahydroisoindol-2-yl)-N-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 167151971) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 2-(7a-formyl-3-oxo-1,3a,4,5,6,7-hexahydroisoindol-2-yl)-N-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-(7a-formyl-3-oxo-1,3a,4,5,6,7-hexahydroisoindol-2-yl)-N-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 167151971 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(7a-formyl-3-oxo-1,3a,4,5,6,7-hexahydroisoindol-2-yl)-N-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | O=CC12CCCCC1C(=O)N(c1sc3c(c1C(=O)Nc1ccc(Cl)cc1)CCC3)C2 |
| InChI | InChI=1S/C23H23ClN2O3S/c24-14-7-9-15(10-8-14)25-20(28)19-16-4-3-6-18(16)30-22(19)26-12-23(13-27)11-2-1-5-17(23)21(26)29/h7-10,13,17H,1-6,11-12H2,(H,25,28) |
| InChIKey | BSRDQKIDHFRUBN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|