About 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal
5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal (PubChem CID 167153718) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal.
Molecular Properties
| Compound Name | 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal |
| PubChem CID | 167153718 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal |
| SMILES | O=CCCCCc1nc(C2CCOCC2)no1 |
| InChI | InChI=1S/C12H18N2O3/c15-7-3-1-2-4-11-13-12(14-17-11)10-5-8-16-9-6-10/h7,10H,1-6,8-9H2 |
| InChIKey | OAKNXTAXMDOYRR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal?
The IUPAC name of 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal (CID 167153718) is 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal.
What is the SMILES notation for 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal?
The canonical SMILES for 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal is O=CCCCCc1nc(C2CCOCC2)no1.
What is the InChIKey of 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal?
The InChIKey is OAKNXTAXMDOYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c15-7-3-1-2-4-11-13-12(14-17-11)10-5-8-16-9-6-10/h7,10H,1-6,8-9H2.
What are the key properties of 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal?
5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal has a molecular weight of 238.29 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentanal is sourced from PubChem (CID 167153718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).