C30H39FO6 — CID 167153802
[2-[(1S,2S,4R,6S,7S,9S,10R,11S)-10-fluoro-9-hydroxy-4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-12,15-dienyl]-2-oxoethyl] 5-(oxiran-2-yl)pentanoate (PubChem CID 167153802) has the molecular formula C30H39FO6 and a molecular weight of 514.63 g/mol. Its IUPAC name is [2-[(1S,2S,4R,6S,7S,9S,10R,11S)-10-fluoro-9-hydroxy-4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-12,15-dienyl]-2-oxoethyl] 5-(oxiran-2-yl)pentanoate.
| Compound Name | [2-[(1S,2S,4R,6S,7S,9S,10R,11S)-10-fluoro-9-hydroxy-4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-12,15-dienyl]-2-oxoethyl] 5-(oxiran-2-yl)pentanoate |
|---|---|
| PubChem CID | 167153802 |
| Molecular Formula | C30H39FO6 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | [2-[(1S,2S,4R,6S,7S,9S,10R,11S)-10-fluoro-9-hydroxy-4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-12,15-dienyl]-2-oxoethyl] 5-(oxiran-2-yl)pentanoate |
| SMILES | C[C@]12C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@]1(C(=O)COC(=O)CCCCC1CO1)C2 |
| InChI | InChI=1S/C30H39FO6/c1-26-13-22-21-9-8-18-12-19(32)10-11-27(18,2)30(21,31)23(33)14-28(22,3)29(26,17-26)24(34)16-37-25(35)7-5-4-6-20-15-36-20/h10-12,20-23,33H,4-9,13-17H2,1-3H3/t20?,21-,22-,23-,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | LSQNIPDNSBIDOL-IUTVSZSVSA-N |
| XLogP | 4.43 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|