C54H45N3S — CID 167154520
5-[3-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]phenyl]-3-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-1-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 167154520) has the molecular formula C54H45N3S and a molecular weight of 768.04 g/mol. Its IUPAC name is 5-[3-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]phenyl]-3-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-1-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 5-[3-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]phenyl]-3-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 167154520 |
| Molecular Formula | C54H45N3S |
| Molecular Weight | 768.04 g/mol |
| Exact Mass | 767.33 |
| IUPAC Name | 5-[3-[N-(5a,9a-dihydrodibenzothiophen-2-yl)anilino]phenyl]-3-N-cyclohexa-1,3-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-1-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | C1=CCCC(N(c2ccccc2)c2cc(-c3cccc(N(c4ccccc4)c4ccc5c(c4)C4C=CC=CC4S5)c3)cc(N(c3ccccc3)C3C=CC=CC3)c2)=C1 |
| InChI | InChI=1S/C54H45N3S/c1-6-20-42(21-7-1)55(43-22-8-2-9-23-43)49-36-41(37-50(38-49)56(44-24-10-3-11-25-44)45-26-12-4-13-27-45)40-19-18-30-47(35-40)57(46-28-14-5-15-29-46)48-33-34-54-52(39-48)51-31-16-17-32-53(51)58-54/h1-12,14-22,24-26,28-39,43,51,53H,13,23,27H2 |
| InChIKey | FLPRDXOWOHRNDR-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.04 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |