C21H20I4O2 — CID 167154756
4,4',6,6'-tetraiodo-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 167154756) has the molecular formula C21H20I4O2 and a molecular weight of 812.00 g/mol. Its IUPAC name is 4,4',6,6'-tetraiodo-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 4,4',6,6'-tetraiodo-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 167154756 |
| Molecular Formula | C21H20I4O2 |
| Molecular Weight | 812.00 g/mol |
| Exact Mass | 811.76 |
| IUPAC Name | 4,4',6,6'-tetraiodo-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(I)c(O)c(I)c32)c2c1cc(I)c(O)c2I |
| InChI | InChI=1S/C21H20I4O2/c1-19(2)7-21(13-9(19)5-11(22)17(26)15(13)24)8-20(3,4)10-6-12(23)18(27)16(25)14(10)21/h5-6,26-27H,7-8H2,1-4H3 |
| InChIKey | YLPRKIYAQRHYJE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.00 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|