C19H39N — CID 167154849
3,9-diethyl-N,N,9-trimethyldodec-10-en-3-amine (PubChem CID 167154849) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 3,9-diethyl-N,N,9-trimethyldodec-10-en-3-amine.
| Compound Name | 3,9-diethyl-N,N,9-trimethyldodec-10-en-3-amine |
|---|---|
| PubChem CID | 167154849 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 3,9-diethyl-N,N,9-trimethyldodec-10-en-3-amine |
| SMILES | CC=CC(C)(CC)CCCCCC(CC)(CC)N(C)C |
| InChI | InChI=1S/C19H39N/c1-8-15-18(5,9-2)16-13-12-14-17-19(10-3,11-4)20(6)7/h8,15H,9-14,16-17H2,1-7H3 |
| InChIKey | UHYAUQHQDXDWMB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|