C12H23N3O — CID 167155405
(1Z)-1-N',1-N',3-N-trimethyl-1-N-(oxan-4-yl)buta-1,3-diene-1,1,3-triamine (PubChem CID 167155405) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (1Z)-1-N',1-N',3-N-trimethyl-1-N-(oxan-4-yl)buta-1,3-diene-1,1,3-triamine.
| Compound Name | (1Z)-1-N',1-N',3-N-trimethyl-1-N-(oxan-4-yl)buta-1,3-diene-1,1,3-triamine |
|---|---|
| PubChem CID | 167155405 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (1Z)-1-N',1-N',3-N-trimethyl-1-N-(oxan-4-yl)buta-1,3-diene-1,1,3-triamine |
| SMILES | C=C(/C=C(/NC1CCOCC1)N(C)C)NC |
| InChI | InChI=1S/C12H23N3O/c1-10(13-2)9-12(15(3)4)14-11-5-7-16-8-6-11/h9,11,13-14H,1,5-8H2,2-4H3/b12-9- |
| InChIKey | LPYZWLRKUWDHMW-XFXZXTDPSA-N |
| XLogP | 0.89 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|