C21H33N2O3PS2 — CID 167155491
3-[[di(propan-2-yl)amino]-[(4S,5S)-5-(4-methoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 167155491) has the molecular formula C21H33N2O3PS2 and a molecular weight of 456.61 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(4S,5S)-5-(4-methoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(4S,5S)-5-(4-methoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 167155491 |
| Molecular Formula | C21H33N2O3PS2 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(4S,5S)-5-(4-methoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | COc1ccc([C@@H]2SSC(C)(C)[C@H]2OP(OCCC#N)N(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C21H33N2O3PS2/c1-15(2)23(16(3)4)27(25-14-8-13-22)26-20-19(28-29-21(20,5)6)17-9-11-18(24-7)12-10-17/h9-12,15-16,19-20H,8,14H2,1-7H3/t19-,20-,27?/m0/s1 |
| InChIKey | PDOCNXPAISCUNU-BPGSNBDMSA-N |
| XLogP | 6.57 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|