C22H22Cl2N8O — CID 167155774
(S)-[3-[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]-1H-indazol-5-yl]oxy-(3,5-dichloro-4-pyridinyl)methanamine (PubChem CID 167155774) has the molecular formula C22H22Cl2N8O and a molecular weight of 485.38 g/mol. Its IUPAC name is (S)-[3-[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]-1H-indazol-5-yl]oxy-(3,5-dichloro-4-pyridinyl)methanamine.
| Compound Name | (S)-[3-[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]-1H-indazol-5-yl]oxy-(3,5-dichloro-4-pyridinyl)methanamine |
|---|---|
| PubChem CID | 167155774 |
| Molecular Formula | C22H22Cl2N8O |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (S)-[3-[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]-1H-indazol-5-yl]oxy-(3,5-dichloro-4-pyridinyl)methanamine |
| SMILES | N[C@@H](Oc1ccc2[nH]nc(-c3cnc(N4CCCNCC4)nc3)c2c1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C22H22Cl2N8O/c23-16-11-27-12-17(24)19(16)21(25)33-14-2-3-18-15(8-14)20(31-30-18)13-9-28-22(29-10-13)32-6-1-4-26-5-7-32/h2-3,8-12,21,26H,1,4-7,25H2,(H,30,31)/t21-/m0/s1 |
| InChIKey | HZZYMCWRSQNLSL-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|