C25H25Cl2FN8O3S — CID 167156341
5-[2-amino-5-[(S)-amino-(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-4-fluorobenzenecarboximidoyl]-2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carbonitrile (PubChem CID 167156341) has the molecular formula C25H25Cl2FN8O3S and a molecular weight of 607.50 g/mol. Its IUPAC name is 5-[2-amino-5-[(S)-amino-(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-4-fluorobenzenecarboximidoyl]-2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-4-fluorobenzenecarboximidoyl]-2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167156341 |
| Molecular Formula | C25H25Cl2FN8O3S |
| Molecular Weight | 607.50 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-4-fluorobenzenecarboximidoyl]-2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(N2CCN(S(C)(=O)=O)CC2)c(C#N)c1)c1cc(O[C@H](N)c2c(Cl)cnc(C)c2Cl)c(F)cc1N |
| InChI | InChI=1S/C25H25Cl2FN8O3S/c1-13-22(27)21(17(26)12-33-13)24(32)39-20-8-16(19(30)9-18(20)28)23(31)15-7-14(10-29)25(34-11-15)35-3-5-36(6-4-35)40(2,37)38/h7-9,11-12,24,31H,3-6,30,32H2,1-2H3/b31-23+/t24-/m0/s1 |
| InChIKey | LRFOTLXBTPTKLJ-GUHNTWAQSA-N |
| XLogP | 3.22 |
| TPSA | 175.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|