C20H17F3IN3O2S — CID 167156479
N-[2-[3-(iodomethyl)cyclobutyl]-5-methoxy-1,3-benzothiazol-6-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 167156479) has the molecular formula C20H17F3IN3O2S and a molecular weight of 547.34 g/mol. Its IUPAC name is N-[2-[3-(iodomethyl)cyclobutyl]-5-methoxy-1,3-benzothiazol-6-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[3-(iodomethyl)cyclobutyl]-5-methoxy-1,3-benzothiazol-6-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167156479 |
| Molecular Formula | C20H17F3IN3O2S |
| Molecular Weight | 547.34 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | N-[2-[3-(iodomethyl)cyclobutyl]-5-methoxy-1,3-benzothiazol-6-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | COc1cc2nc(C3CC(CI)C3)sc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H17F3IN3O2S/c1-29-15-7-14-16(30-19(27-14)11-5-10(6-11)9-24)8-13(15)26-18(28)12-3-2-4-17(25-12)20(21,22)23/h2-4,7-8,10-11H,5-6,9H2,1H3,(H,26,28) |
| InChIKey | IUDHQKBSVZQKRU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|