C21H33NS — CID 167156689
(3E,5Z)-N-[3-[(Z)-but-2-en-2-yl]sulfanylbut-3-en-2-yl]-3,6-dimethyl-N-prop-2-enylocta-3,5,7-trien-2-amine (PubChem CID 167156689) has the molecular formula C21H33NS and a molecular weight of 331.57 g/mol. Its IUPAC name is (3E,5Z)-N-[3-[(Z)-but-2-en-2-yl]sulfanylbut-3-en-2-yl]-3,6-dimethyl-N-prop-2-enylocta-3,5,7-trien-2-amine.
| Compound Name | (3E,5Z)-N-[3-[(Z)-but-2-en-2-yl]sulfanylbut-3-en-2-yl]-3,6-dimethyl-N-prop-2-enylocta-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 167156689 |
| Molecular Formula | C21H33NS |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (3E,5Z)-N-[3-[(Z)-but-2-en-2-yl]sulfanylbut-3-en-2-yl]-3,6-dimethyl-N-prop-2-enylocta-3,5,7-trien-2-amine |
| SMILES | C=CCN(C(C)C(=C)S/C(C)=C\C)C(C)/C(C)=C/C=C(/C)C=C |
| InChI | InChI=1S/C21H33NS/c1-10-15-22(20(8)21(9)23-18(6)12-3)19(7)17(5)14-13-16(4)11-2/h10-14,19-20H,1-2,9,15H2,3-8H3/b16-13-,17-14+,18-12- |
| InChIKey | WKSADZYZURSROW-RIORVMMESA-N |
| XLogP | 6.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|