C22H24F3N7O — CID 167157801
4-[5-(4-amino-3-methanimidoyl-2-propan-2-ylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 167157801) has the molecular formula C22H24F3N7O and a molecular weight of 459.48 g/mol. Its IUPAC name is 4-[5-(4-amino-3-methanimidoyl-2-propan-2-ylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[5-(4-amino-3-methanimidoyl-2-propan-2-ylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 167157801 |
| Molecular Formula | C22H24F3N7O |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-[5-(4-amino-3-methanimidoyl-2-propan-2-ylanilino)-1-methyl-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nc(-c3ccc(C(=O)NCC(F)(F)F)cc3)nn2C)c1C(C)C |
| InChI | InChI=1S/C22H24F3N7O/c1-12(2)18-15(10-26)16(27)8-9-17(18)29-21-30-19(31-32(21)3)13-4-6-14(7-5-13)20(33)28-11-22(23,24)25/h4-10,12,26H,11,27H2,1-3H3,(H,28,33)(H,29,30,31)/b26-10+ |
| InChIKey | ZRWZLNQQAXRZPL-NSKAYECMSA-N |
| XLogP | 4.22 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|