C11H12N2S — CID 167157837
4-cyclopropyl-5-methylsulfanyl-1H-indazole (PubChem CID 167157837) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-cyclopropyl-5-methylsulfanyl-1H-indazole.
| Compound Name | 4-cyclopropyl-5-methylsulfanyl-1H-indazole |
|---|---|
| PubChem CID | 167157837 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-cyclopropyl-5-methylsulfanyl-1H-indazole |
| SMILES | CSc1ccc2[nH]ncc2c1C1CC1 |
| InChI | InChI=1S/C11H12N2S/c1-14-10-5-4-9-8(6-12-13-9)11(10)7-2-3-7/h4-7H,2-3H2,1H3,(H,12,13) |
| InChIKey | NLMNJUWFBPFVON-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |