About 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one
1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one (PubChem CID 167160566) has the molecular formula C13H21N5O2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one.
Molecular Properties
| Compound Name | 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one |
| PubChem CID | 167160566 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one |
| SMILES | CN1CCC(O)(Cn2cnc3c(c2=O)NCN3C)CC1 |
| InChI | InChI=1S/C13H21N5O2/c1-16-5-3-13(20,4-6-16)7-18-9-15-11-10(12(18)19)14-8-17(11)2/h9,14,20H,3-8H2,1-2H3 |
| InChIKey | KODSXNWLVMVSBS-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one?
The IUPAC name of 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one (CID 167160566) is 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one.
What is the SMILES notation for 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one?
The canonical SMILES for 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one is CN1CCC(O)(Cn2cnc3c(c2=O)NCN3C)CC1.
What is the InChIKey of 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one?
The InChIKey is KODSXNWLVMVSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2/c1-16-5-3-13(20,4-6-16)7-18-9-15-11-10(12(18)19)14-8-17(11)2/h9,14,20H,3-8H2,1-2H3.
What are the key properties of 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one?
1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one has a molecular weight of 279.34 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-9-methyl-7,8-dihydropurin-6-one is sourced from PubChem (CID 167160566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).